C16H32N2 — CID 91190722
4-ethyl-1-methyl-3,6-dihydro-2H-pyridine;4-ethyl-1-methylpiperidine (PubChem CID 91190722) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 4-ethyl-1-methyl-3,6-dihydro-2H-pyridine;4-ethyl-1-methylpiperidine.
| Compound Name | 4-ethyl-1-methyl-3,6-dihydro-2H-pyridine;4-ethyl-1-methylpiperidine |
|---|---|
| PubChem CID | 91190722 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 4-ethyl-1-methyl-3,6-dihydro-2H-pyridine;4-ethyl-1-methylpiperidine |
| SMILES | CCC1=CCN(C)CC1.CCC1CCN(C)CC1 |
| InChI | InChI=1S/C8H17N.C8H15N/c2*1-3-8-4-6-9(2)7-5-8/h8H,3-7H2,1-2H3;4H,3,5-7H2,1-2H3 |
| InChIKey | GLPSDAAYJDKTIY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|