C18H32N+ — CID 3906191
1-prop-2-enyl-1-[(2,4,6-trimethylcyclohex-3-en-1-yl)methyl]piperidin-1-ium (PubChem CID 3906191) has the molecular formula C18H32N+ and a molecular weight of 262.46 g/mol. Its IUPAC name is 1-prop-2-enyl-1-[(2,4,6-trimethylcyclohex-3-en-1-yl)methyl]piperidin-1-ium.
| Compound Name | 1-prop-2-enyl-1-[(2,4,6-trimethylcyclohex-3-en-1-yl)methyl]piperidin-1-ium |
|---|---|
| PubChem CID | 3906191 |
| Molecular Formula | C18H32N+ |
| Molecular Weight | 262.46 g/mol |
| Exact Mass | 262.25 |
| IUPAC Name | 1-prop-2-enyl-1-[(2,4,6-trimethylcyclohex-3-en-1-yl)methyl]piperidin-1-ium |
| SMILES | C=CC[N+]1(CC2C(C)C=C(C)CC2C)CCCCC1 |
| InChI | InChI=1S/C18H32N/c1-5-9-19(10-7-6-8-11-19)14-18-16(3)12-15(2)13-17(18)4/h5,12,16-18H,1,6-11,13-14H2,2-4H3/q+1 |
| InChIKey | UDMJNZRMOVJSLS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.46 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|