C20H38F2N2 — CID 156799121
3,3-difluoro-4-methyl-1-propan-2-ylpiperidine;1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 156799121) has the molecular formula C20H38F2N2 and a molecular weight of 344.53 g/mol. Its IUPAC name is 3,3-difluoro-4-methyl-1-propan-2-ylpiperidine;1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 3,3-difluoro-4-methyl-1-propan-2-ylpiperidine;1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 156799121 |
| Molecular Formula | C20H38F2N2 |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.30 |
| IUPAC Name | 3,3-difluoro-4-methyl-1-propan-2-ylpiperidine;1,4-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C1=CCN(C(C)C)CC1.CC(C)N1CCC(C)C(F)(F)C1 |
| InChI | InChI=1S/C11H21N.C9H17F2N/c1-9(2)11-5-7-12(8-6-11)10(3)4;1-7(2)12-5-4-8(3)9(10,11)6-12/h5,9-10H,6-8H2,1-4H3;7-8H,4-6H2,1-3H3 |
| InChIKey | WZBNSQLDMBGOLS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|