C13H25F2N — CID 177353252
3,3-difluoro-1,4-di(propan-2-yl)-2,6-dihydropyridine;ethane (PubChem CID 177353252) has the molecular formula C13H25F2N and a molecular weight of 233.35 g/mol. Its IUPAC name is 3,3-difluoro-1,4-di(propan-2-yl)-2,6-dihydropyridine;ethane.
| Compound Name | 3,3-difluoro-1,4-di(propan-2-yl)-2,6-dihydropyridine;ethane |
|---|---|
| PubChem CID | 177353252 |
| Molecular Formula | C13H25F2N |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.20 |
| IUPAC Name | 3,3-difluoro-1,4-di(propan-2-yl)-2,6-dihydropyridine;ethane |
| SMILES | CC.CC(C)C1=CCN(C(C)C)CC1(F)F |
| InChI | InChI=1S/C11H19F2N.C2H6/c1-8(2)10-5-6-14(9(3)4)7-11(10,12)13;1-2/h5,8-9H,6-7H2,1-4H3;1-2H3 |
| InChIKey | ZYINSHQSADBWDE-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|