C12H21F2N — CID 140596328
1-(difluoromethyl)-4,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 140596328) has the molecular formula C12H21F2N and a molecular weight of 217.30 g/mol. Its IUPAC name is 1-(difluoromethyl)-4,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(difluoromethyl)-4,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 140596328 |
| Molecular Formula | C12H21F2N |
| Molecular Weight | 217.30 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-(difluoromethyl)-4,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C1=C(C(C)C)CN(C(F)F)CC1 |
| InChI | InChI=1S/C12H21F2N/c1-8(2)10-5-6-15(12(13)14)7-11(10)9(3)4/h8-9,12H,5-7H2,1-4H3 |
| InChIKey | RGUQUAILZPHEGU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.30 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|