C11H19F2N — CID 140596337
1-(difluoromethyl)-3,4-di(propan-2-yl)-2,5-dihydropyrrole (PubChem CID 140596337) has the molecular formula C11H19F2N and a molecular weight of 203.28 g/mol. Its IUPAC name is 1-(difluoromethyl)-3,4-di(propan-2-yl)-2,5-dihydropyrrole.
| Compound Name | 1-(difluoromethyl)-3,4-di(propan-2-yl)-2,5-dihydropyrrole |
|---|---|
| PubChem CID | 140596337 |
| Molecular Formula | C11H19F2N |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 1-(difluoromethyl)-3,4-di(propan-2-yl)-2,5-dihydropyrrole |
| SMILES | CC(C)C1=C(C(C)C)CN(C(F)F)C1 |
| InChI | InChI=1S/C11H19F2N/c1-7(2)9-5-14(11(12)13)6-10(9)8(3)4/h7-8,11H,5-6H2,1-4H3 |
| InChIKey | HQTJRULDGHESRS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|