About 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine
4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 176790190) has the molecular formula C11H20FN
and a molecular weight of 185.29 g/mol. Its IUPAC name is 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
Analyze 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine (CID 176790190) is 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine is CC(C)C1=C(F)CCN(C(C)C)C1.
What is the InChIKey of 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is XLGYJUNSMVOQIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20FN/c1-8(2)10-7-13(9(3)4)6-5-11(10)12/h8-9H,5-7H2,1-4H3.
What are the key properties of 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 185.29 g/mol, XLogP of 2.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 176790190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).