C8H14FN — CID 177107862
3-fluoro-1,4,5-trimethyl-3,6-dihydro-2H-pyridine (PubChem CID 177107862) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is 3-fluoro-1,4,5-trimethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 3-fluoro-1,4,5-trimethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 177107862 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 3-fluoro-1,4,5-trimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C(C)C(F)CN(C)C1 |
| InChI | InChI=1S/C8H14FN/c1-6-4-10(3)5-8(9)7(6)2/h8H,4-5H2,1-3H3 |
| InChIKey | ZSBQHHMOYVMTPC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|