C10H14FN — CID 143404568
4,5-bis(ethenyl)-2-fluoro-1-methyl-3,6-dihydro-2H-pyridine (PubChem CID 143404568) has the molecular formula C10H14FN and a molecular weight of 167.23 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2-fluoro-1-methyl-3,6-dihydro-2H-pyridine.
| Compound Name | 4,5-bis(ethenyl)-2-fluoro-1-methyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 143404568 |
| Molecular Formula | C10H14FN |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 4,5-bis(ethenyl)-2-fluoro-1-methyl-3,6-dihydro-2H-pyridine |
| SMILES | C=CC1=C(C=C)CN(C)C(F)C1 |
| InChI | InChI=1S/C10H14FN/c1-4-8-6-10(11)12(3)7-9(8)5-2/h4-5,10H,1-2,6-7H2,3H3 |
| InChIKey | APHVOLKFXWRIST-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|