C12H24FN — CID 134593961
(Z)-N,N-diethyl-4-fluoro-5-methylhept-4-en-1-amine (PubChem CID 134593961) has the molecular formula C12H24FN and a molecular weight of 201.33 g/mol. Its IUPAC name is (Z)-N,N-diethyl-4-fluoro-5-methylhept-4-en-1-amine.
| Compound Name | (Z)-N,N-diethyl-4-fluoro-5-methylhept-4-en-1-amine |
|---|---|
| PubChem CID | 134593961 |
| Molecular Formula | C12H24FN |
| Molecular Weight | 201.33 g/mol |
| Exact Mass | 201.19 |
| IUPAC Name | (Z)-N,N-diethyl-4-fluoro-5-methylhept-4-en-1-amine |
| SMILES | CC/C(C)=C(\F)CCCN(CC)CC |
| InChI | InChI=1S/C12H24FN/c1-5-11(4)12(13)9-8-10-14(6-2)7-3/h5-10H2,1-4H3/b12-11- |
| InChIKey | WQUSIRXZFSVURF-QXMHVHEDSA-N |
| XLogP | 3.76 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |