C11H20FN — CID 131106328
1-(2-fluorobutyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine (PubChem CID 131106328) has the molecular formula C11H20FN and a molecular weight of 185.29 g/mol. Its IUPAC name is 1-(2-fluorobutyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2-fluorobutyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 131106328 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | 1-(2-fluorobutyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CCC(F)CN1CCC(C)=C(C)C1 |
| InChI | InChI=1S/C11H20FN/c1-4-11(12)8-13-6-5-9(2)10(3)7-13/h11H,4-8H2,1-3H3 |
| InChIKey | DVELGEIMWSKBJG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|