C9H15F2N — CID 131084449
1-(2,2-difluoroethyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine (PubChem CID 131084449) has the molecular formula C9H15F2N and a molecular weight of 175.22 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2,2-difluoroethyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 131084449 |
| Molecular Formula | C9H15F2N |
| Molecular Weight | 175.22 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4,5-dimethyl-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C(C)CN(CC(F)F)CC1 |
| InChI | InChI=1S/C9H15F2N/c1-7-3-4-12(5-8(7)2)6-9(10)11/h9H,3-6H2,1-2H3 |
| InChIKey | IDTPUIQEJVNHFU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.22 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|