C8H12F3N — CID 155160951
(3Z)-1-methyl-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine (PubChem CID 155160951) has the molecular formula C8H12F3N and a molecular weight of 179.19 g/mol. Its IUPAC name is (3Z)-1-methyl-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine.
| Compound Name | (3Z)-1-methyl-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine |
|---|---|
| PubChem CID | 155160951 |
| Molecular Formula | C8H12F3N |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (3Z)-1-methyl-3-(1,1,1-trifluoropropan-2-ylidene)pyrrolidine |
| SMILES | C/C(=C1\CCN(C)C1)C(F)(F)F |
| InChI | InChI=1S/C8H12F3N/c1-6(8(9,10)11)7-3-4-12(2)5-7/h3-5H2,1-2H3/b7-6- |
| InChIKey | UGPBJGMILOVSSW-SREVYHEPSA-N |
| XLogP | 2.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|