C10H8F11N — CID 13196941
1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyrrolidine (PubChem CID 13196941) has the molecular formula C10H8F11N and a molecular weight of 351.16 g/mol. Its IUPAC name is 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyrrolidine.
| Compound Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyrrolidine |
|---|---|
| PubChem CID | 13196941 |
| Molecular Formula | C10H8F11N |
| Molecular Weight | 351.16 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 1-[1,1,1,4,4,5,5,5-octafluoro-2-(trifluoromethyl)pent-2-en-3-yl]pyrrolidine |
| SMILES | FC(F)(F)C(=C(N1CCCC1)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H8F11N/c11-7(12,10(19,20)21)6(22-3-1-2-4-22)5(8(13,14)15)9(16,17)18/h1-4H2 |
| InChIKey | XOZDWNSVXRCHNO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.16 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|