C10H17F2N — CID 176702205
1-(2,2-difluoroethyl)-4-propan-2-yl-3,6-dihydro-2H-pyridine (PubChem CID 176702205) has the molecular formula C10H17F2N and a molecular weight of 189.25 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-propan-2-yl-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(2,2-difluoroethyl)-4-propan-2-yl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 176702205 |
| Molecular Formula | C10H17F2N |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-propan-2-yl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)C1=CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C10H17F2N/c1-8(2)9-3-5-13(6-4-9)7-10(11)12/h3,8,10H,4-7H2,1-2H3 |
| InChIKey | DSHLMQMYPBSESG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|