C11H18F3N — CID 140996572
1-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]piperidine (PubChem CID 140996572) has the molecular formula C11H18F3N and a molecular weight of 221.27 g/mol. Its IUPAC name is 1-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]piperidine.
| Compound Name | 1-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]piperidine |
|---|---|
| PubChem CID | 140996572 |
| Molecular Formula | C11H18F3N |
| Molecular Weight | 221.27 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 1-[(Z)-5,5,5-trifluoro-4-methylpent-3-enyl]piperidine |
| SMILES | C/C(=C/CCN1CCCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H18F3N/c1-10(11(12,13)14)6-5-9-15-7-3-2-4-8-15/h6H,2-5,7-9H2,1H3/b10-6- |
| InChIKey | WMSBJLKGGQIJLE-POHAHGRESA-N |
| XLogP | 3.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.27 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|