C12H16F3N — CID 91187711
1-[2-(trifluoromethyl)cyclohexa-2,5-dien-1-yl]piperidine (PubChem CID 91187711) has the molecular formula C12H16F3N and a molecular weight of 231.26 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)cyclohexa-2,5-dien-1-yl]piperidine.
| Compound Name | 1-[2-(trifluoromethyl)cyclohexa-2,5-dien-1-yl]piperidine |
|---|---|
| PubChem CID | 91187711 |
| Molecular Formula | C12H16F3N |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 1-[2-(trifluoromethyl)cyclohexa-2,5-dien-1-yl]piperidine |
| SMILES | FC(F)(F)C1=CCC=CC1N1CCCCC1 |
| InChI | InChI=1S/C12H16F3N/c13-12(14,15)10-6-2-3-7-11(10)16-8-4-1-5-9-16/h3,6-7,11H,1-2,4-5,8-9H2 |
| InChIKey | AHNINCNDEAEZSA-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|