C13H19F2N — CID 145285196
(2R)-4,4-difluoro-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine (PubChem CID 145285196) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is (2R)-4,4-difluoro-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine.
| Compound Name | (2R)-4,4-difluoro-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine |
|---|---|
| PubChem CID | 145285196 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | (2R)-4,4-difluoro-2-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-1-methylpiperidine |
| SMILES | C=C(/C=C\C=C/C)[C@H]1CC(F)(F)CCN1C |
| InChI | InChI=1S/C13H19F2N/c1-4-5-6-7-11(2)12-10-13(14,15)8-9-16(12)3/h4-7,12H,2,8-10H2,1,3H3/b5-4-,7-6-/t12-/m1/s1 |
| InChIKey | ALHGWRHSXLAOBJ-ZVDWRRAGSA-N |
| XLogP | 3.40 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|