C17H29F3N2 — CID 144962869
ethane;N-[(3E)-3-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-yl]-N,1-dimethylpiperidin-4-amine (PubChem CID 144962869) has the molecular formula C17H29F3N2 and a molecular weight of 318.43 g/mol. Its IUPAC name is ethane;N-[(3E)-3-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-yl]-N,1-dimethylpiperidin-4-amine.
| Compound Name | ethane;N-[(3E)-3-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-yl]-N,1-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 144962869 |
| Molecular Formula | C17H29F3N2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | ethane;N-[(3E)-3-ethenyl-1,1,1-trifluorohexa-3,5-dien-2-yl]-N,1-dimethylpiperidin-4-amine |
| SMILES | C=C/C=C(\C=C)C(N(C)C1CCN(C)CC1)C(F)(F)F.CC |
| InChI | InChI=1S/C15H23F3N2.C2H6/c1-5-7-12(6-2)14(15(16,17)18)20(4)13-8-10-19(3)11-9-13;1-2/h5-7,13-14H,1-2,8-11H2,3-4H3;1-2H3/b12-7+; |
| InChIKey | OHIDIKXZALLGPK-RRAJOLSVSA-N |
| XLogP | 4.27 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|