C16H24F3N — CID 146693104
(2R,4S)-4-(difluoromethyl)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-1-propan-2-ylpiperidine (PubChem CID 146693104) has the molecular formula C16H24F3N and a molecular weight of 287.37 g/mol. Its IUPAC name is (2R,4S)-4-(difluoromethyl)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-1-propan-2-ylpiperidine.
| Compound Name | (2R,4S)-4-(difluoromethyl)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-1-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 146693104 |
| Molecular Formula | C16H24F3N |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | (2R,4S)-4-(difluoromethyl)-2-[(3Z,5E)-5-fluorohepta-1,3,5-trien-2-yl]-1-propan-2-ylpiperidine |
| SMILES | C=C(/C=C\C(F)=C/C)[C@H]1C[C@@H](C(F)F)CCN1C(C)C |
| InChI | InChI=1S/C16H24F3N/c1-5-14(17)7-6-12(4)15-10-13(16(18)19)8-9-20(15)11(2)3/h5-7,11,13,15-16H,4,8-10H2,1-3H3/b7-6-,14-5+/t13-,15+/m0/s1 |
| InChIKey | QKSQDXYTLNIMQQ-WHHGTROHSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|