C26H31N3S2 — CID 130239535
3-(5,5-dimethyl-3-prop-1-en-2-yl-6,7-dihydro-4H-1-benzothiophen-2-yl)-4-(5-sulfanyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)benzonitrile (PubChem CID 130239535) has the molecular formula C26H31N3S2 and a molecular weight of 449.69 g/mol. Its IUPAC name is 3-(5,5-dimethyl-3-prop-1-en-2-yl-6,7-dihydro-4H-1-benzothiophen-2-yl)-4-(5-sulfanyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)benzonitrile.
| Compound Name | 3-(5,5-dimethyl-3-prop-1-en-2-yl-6,7-dihydro-4H-1-benzothiophen-2-yl)-4-(5-sulfanyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)benzonitrile |
|---|---|
| PubChem CID | 130239535 |
| Molecular Formula | C26H31N3S2 |
| Molecular Weight | 449.69 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 3-(5,5-dimethyl-3-prop-1-en-2-yl-6,7-dihydro-4H-1-benzothiophen-2-yl)-4-(5-sulfanyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-2-yl)benzonitrile |
| SMILES | C=C(C)c1c(-c2cc(C#N)ccc2N2CC3CN(S)CC3C2)sc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C26H31N3S2/c1-16(2)24-21-10-26(3,4)8-7-23(21)31-25(24)20-9-17(11-27)5-6-22(20)28-12-18-14-29(30)15-19(18)13-28/h5-6,9,18-19,30H,1,7-8,10,12-15H2,2-4H3 |
| InChIKey | KISNODWVWHVECW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 30.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|