C23H30N2OS2 — CID 130240361
1-[2-[4-(azetidin-1-yl)-2-[[methyl(sulfanyl)amino]methyl]phenyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol (PubChem CID 130240361) has the molecular formula C23H30N2OS2 and a molecular weight of 414.64 g/mol. Its IUPAC name is 1-[2-[4-(azetidin-1-yl)-2-[[methyl(sulfanyl)amino]methyl]phenyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol.
| Compound Name | 1-[2-[4-(azetidin-1-yl)-2-[[methyl(sulfanyl)amino]methyl]phenyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol |
|---|---|
| PubChem CID | 130240361 |
| Molecular Formula | C23H30N2OS2 |
| Molecular Weight | 414.64 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 1-[2-[4-(azetidin-1-yl)-2-[[methyl(sulfanyl)amino]methyl]phenyl]-5,5-dimethyl-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol |
| SMILES | C=C(O)c1c(-c2ccc(N3CCC3)cc2CN(C)S)sc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C23H30N2OS2/c1-15(26)21-19-13-23(2,3)9-8-20(19)28-22(21)18-7-6-17(25-10-5-11-25)12-16(18)14-24(4)27/h6-7,12,26-27H,1,5,8-11,13-14H2,2-4H3 |
| InChIKey | MZVOTMIJJZUTMJ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.64 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|