C20H25NOS2 — CID 130239704
1-[5,5-dimethyl-2-[4-methyl-2-[(sulfanylamino)methyl]phenyl]-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol (PubChem CID 130239704) has the molecular formula C20H25NOS2 and a molecular weight of 359.56 g/mol. Its IUPAC name is 1-[5,5-dimethyl-2-[4-methyl-2-[(sulfanylamino)methyl]phenyl]-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol.
| Compound Name | 1-[5,5-dimethyl-2-[4-methyl-2-[(sulfanylamino)methyl]phenyl]-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol |
|---|---|
| PubChem CID | 130239704 |
| Molecular Formula | C20H25NOS2 |
| Molecular Weight | 359.56 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | 1-[5,5-dimethyl-2-[4-methyl-2-[(sulfanylamino)methyl]phenyl]-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol |
| SMILES | C=C(O)c1c(-c2ccc(C)cc2CNS)sc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C20H25NOS2/c1-12-5-6-15(14(9-12)11-21-23)19-18(13(2)22)16-10-20(3,4)8-7-17(16)24-19/h5-6,9,21-23H,2,7-8,10-11H2,1,3-4H3 |
| InChIKey | ZTCQAZWWVIDZQL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|