C21H23F3OS2 — CID 130239967
1-[5,5-dimethyl-2-[2-(2-sulfanylethyl)-4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol (PubChem CID 130239967) has the molecular formula C21H23F3OS2 and a molecular weight of 412.54 g/mol. Its IUPAC name is 1-[5,5-dimethyl-2-[2-(2-sulfanylethyl)-4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol.
| Compound Name | 1-[5,5-dimethyl-2-[2-(2-sulfanylethyl)-4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol |
|---|---|
| PubChem CID | 130239967 |
| Molecular Formula | C21H23F3OS2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 1-[5,5-dimethyl-2-[2-(2-sulfanylethyl)-4-(trifluoromethyl)phenyl]-6,7-dihydro-4H-1-benzothiophen-3-yl]ethenol |
| SMILES | C=C(O)c1c(-c2ccc(C(F)(F)F)cc2CCS)sc2c1CC(C)(C)CC2 |
| InChI | InChI=1S/C21H23F3OS2/c1-12(25)18-16-11-20(2,3)8-6-17(16)27-19(18)15-5-4-14(21(22,23)24)10-13(15)7-9-26/h4-5,10,25-26H,1,6-9,11H2,2-3H3 |
| InChIKey | HEQYPCFWPBSSHO-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|