C18H26N2S2 — CID 130239565
[5-(6,6-dimethyl-4-prop-1-en-2-yl-1,3,4,5,7,8-hexahydroisothiochromen-3-yl)-1,3-thiazol-2-yl]methanamine (PubChem CID 130239565) has the molecular formula C18H26N2S2 and a molecular weight of 334.55 g/mol. Its IUPAC name is [5-(6,6-dimethyl-4-prop-1-en-2-yl-1,3,4,5,7,8-hexahydroisothiochromen-3-yl)-1,3-thiazol-2-yl]methanamine.
| Compound Name | [5-(6,6-dimethyl-4-prop-1-en-2-yl-1,3,4,5,7,8-hexahydroisothiochromen-3-yl)-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 130239565 |
| Molecular Formula | C18H26N2S2 |
| Molecular Weight | 334.55 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | [5-(6,6-dimethyl-4-prop-1-en-2-yl-1,3,4,5,7,8-hexahydroisothiochromen-3-yl)-1,3-thiazol-2-yl]methanamine |
| SMILES | C=C(C)C1C2=C(CCC(C)(C)C2)CSC1c1cnc(CN)s1 |
| InChI | InChI=1S/C18H26N2S2/c1-11(2)16-13-7-18(3,4)6-5-12(13)10-21-17(16)14-9-20-15(8-19)22-14/h9,16-17H,1,5-8,10,19H2,2-4H3 |
| InChIKey | PNSOFYAQEHCKDR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.55 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|