C19H35N3O4 — CID 130240695
2-[2-[[2-(aminomethyl)-2,4,4-trimethylpentanoyl]amino]ethylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 130240695) has the molecular formula C19H35N3O4 and a molecular weight of 369.51 g/mol. Its IUPAC name is 2-[2-[[2-(aminomethyl)-2,4,4-trimethylpentanoyl]amino]ethylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 2-[2-[[2-(aminomethyl)-2,4,4-trimethylpentanoyl]amino]ethylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 130240695 |
| Molecular Formula | C19H35N3O4 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | 2-[2-[[2-(aminomethyl)-2,4,4-trimethylpentanoyl]amino]ethylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | CC(C)(C)CC(C)(CN)C(=O)NCCNC(=O)C1CCCCC1C(=O)O |
| InChI | InChI=1S/C19H35N3O4/c1-18(2,3)11-19(4,12-20)17(26)22-10-9-21-15(23)13-7-5-6-8-14(13)16(24)25/h13-14H,5-12,20H2,1-4H3,(H,21,23)(H,22,26)(H,24,25) |
| InChIKey | KENGKVUGZLYLBQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|