C11H14O5 — CID 130240721
[(4R)-5-prop-2-ynoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] acetate (PubChem CID 130240721) has the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. Its IUPAC name is [(4R)-5-prop-2-ynoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] acetate.
| Compound Name | [(4R)-5-prop-2-ynoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 130240721 |
| Molecular Formula | C11H14O5 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | [(4R)-5-prop-2-ynoxy-2,3,3a,4,5,6a-hexahydrofuro[2,3-b]furan-4-yl] acetate |
| SMILES | C#CCOC1OC2OCCC2[C@H]1OC(C)=O |
| InChI | InChI=1S/C11H14O5/c1-3-5-13-11-9(15-7(2)12)8-4-6-14-10(8)16-11/h1,8-11H,4-6H2,2H3/t8?,9-,10?,11?/m1/s1 |
| InChIKey | AWVYIEVFYPZWGQ-XJPQQVLCSA-N |
| XLogP | 0.29 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|