C29H29N5O — CID 130241452
N-[2-[4-[[amino-[(Z)-2-amino-2-pyridin-3-ylethenyl]amino]methyl]phenyl]ethyl]-2-phenylbenzamide (PubChem CID 130241452) has the molecular formula C29H29N5O and a molecular weight of 463.59 g/mol. Its IUPAC name is N-[2-[4-[[amino-[(Z)-2-amino-2-pyridin-3-ylethenyl]amino]methyl]phenyl]ethyl]-2-phenylbenzamide.
| Compound Name | N-[2-[4-[[amino-[(Z)-2-amino-2-pyridin-3-ylethenyl]amino]methyl]phenyl]ethyl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 130241452 |
| Molecular Formula | C29H29N5O |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | N-[2-[4-[[amino-[(Z)-2-amino-2-pyridin-3-ylethenyl]amino]methyl]phenyl]ethyl]-2-phenylbenzamide |
| SMILES | N/C(=C\N(N)Cc1ccc(CCNC(=O)c2ccccc2-c2ccccc2)cc1)c1cccnc1 |
| InChI | InChI=1S/C29H29N5O/c30-28(25-9-6-17-32-19-25)21-34(31)20-23-14-12-22(13-15-23)16-18-33-29(35)27-11-5-4-10-26(27)24-7-2-1-3-8-24/h1-15,17,19,21H,16,18,20,30-31H2,(H,33,35)/b28-21- |
| InChIKey | GVLWBEYABOXICA-HFTWOUSFSA-N |
| XLogP | 4.35 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|