C10H15NO3 — CID 130242528
(2S)-2-amino-3-(4-methoxyphenyl)propane-1,1-diol (PubChem CID 130242528) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-methoxyphenyl)propane-1,1-diol.
| Compound Name | (2S)-2-amino-3-(4-methoxyphenyl)propane-1,1-diol |
|---|---|
| PubChem CID | 130242528 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | (2S)-2-amino-3-(4-methoxyphenyl)propane-1,1-diol |
| SMILES | COc1ccc(C[C@H](N)C(O)O)cc1 |
| InChI | InChI=1S/C10H15NO3/c1-14-8-4-2-7(3-5-8)6-9(11)10(12)13/h2-5,9-10,12-13H,6,11H2,1H3/t9-/m0/s1 |
| InChIKey | FAOIZOFQQNWSNB-VIFPVBQESA-N |
| XLogP | -0.12 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|