C14H23F2NO — CID 130243061
N-[2-[(4R)-5,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]oxyethyl]pentan-1-amine (PubChem CID 130243061) has the molecular formula C14H23F2NO and a molecular weight of 259.34 g/mol. Its IUPAC name is N-[2-[(4R)-5,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]oxyethyl]pentan-1-amine.
| Compound Name | N-[2-[(4R)-5,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]oxyethyl]pentan-1-amine |
|---|---|
| PubChem CID | 130243061 |
| Molecular Formula | C14H23F2NO |
| Molecular Weight | 259.34 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-[2-[(4R)-5,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]oxyethyl]pentan-1-amine |
| SMILES | CCCCCNCCOC1=CC[C@@H](C)C(F)=C1F |
| InChI | InChI=1S/C14H23F2NO/c1-3-4-5-8-17-9-10-18-12-7-6-11(2)13(15)14(12)16/h7,11,17H,3-6,8-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | NCVZNRLWWZWHMK-LLVKDONJSA-N |
| XLogP | 3.86 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|