C27H41NO2 — CID 130247773
(2S)-1-[4-(3-ethyl-1-adamantyl)phenoxy]-3-(4-methylpiperidin-1-yl)propan-2-ol (PubChem CID 130247773) has the molecular formula C27H41NO2 and a molecular weight of 411.63 g/mol. Its IUPAC name is (2S)-1-[4-(3-ethyl-1-adamantyl)phenoxy]-3-(4-methylpiperidin-1-yl)propan-2-ol.
| Compound Name | (2S)-1-[4-(3-ethyl-1-adamantyl)phenoxy]-3-(4-methylpiperidin-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 130247773 |
| Molecular Formula | C27H41NO2 |
| Molecular Weight | 411.63 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | (2S)-1-[4-(3-ethyl-1-adamantyl)phenoxy]-3-(4-methylpiperidin-1-yl)propan-2-ol |
| SMILES | CCC12CC3CC(C1)CC(c1ccc(OC[C@@H](O)CN4CCC(C)CC4)cc1)(C3)C2 |
| InChI | InChI=1S/C27H41NO2/c1-3-26-13-21-12-22(14-26)16-27(15-21,19-26)23-4-6-25(7-5-23)30-18-24(29)17-28-10-8-20(2)9-11-28/h4-7,20-22,24,29H,3,8-19H2,1-2H3/t21?,22?,24-,26?,27?/m0/s1 |
| InChIKey | KKFWGUNKHXYLLA-CQNMDPSYSA-N |
| XLogP | 5.41 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.63 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |