C29H29ClN4O4 — CID 130248072
1-[(3R)-3-[3-[4-(2-chloro-3-methoxyphenoxy)phenyl]-7-ethoxypyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 130248072) has the molecular formula C29H29ClN4O4 and a molecular weight of 533.03 g/mol. Its IUPAC name is 1-[(3R)-3-[3-[4-(2-chloro-3-methoxyphenoxy)phenyl]-7-ethoxypyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R)-3-[3-[4-(2-chloro-3-methoxyphenoxy)phenyl]-7-ethoxypyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 130248072 |
| Molecular Formula | C29H29ClN4O4 |
| Molecular Weight | 533.03 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | 1-[(3R)-3-[3-[4-(2-chloro-3-methoxyphenoxy)phenyl]-7-ethoxypyrazolo[4,3-c]pyridin-1-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(Oc4cccc(OC)c4Cl)cc3)c3cncc(OCC)c32)C1 |
| InChI | InChI=1S/C29H29ClN4O4/c1-4-26(35)33-15-7-8-20(18-33)34-29-22(16-31-17-25(29)37-5-2)28(32-34)19-11-13-21(14-12-19)38-24-10-6-9-23(36-3)27(24)30/h4,6,9-14,16-17,20H,1,5,7-8,15,18H2,2-3H3/t20-/m1/s1 |
| InChIKey | BLMUPMRIQRWTIM-HXUWFJFHSA-N |
| XLogP | 6.30 |
| TPSA | 78.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.03 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|