C35H48N2O2 — CID 130248136
5-[2-[(4-methoxyphenyl)methyl]-4-methyl-3-oxo-9-pentan-2-yl-9-phenyl-2-azaspiro[5.5]undecan-5-yl]pentanenitrile (PubChem CID 130248136) has the molecular formula C35H48N2O2 and a molecular weight of 528.78 g/mol. Its IUPAC name is 5-[2-[(4-methoxyphenyl)methyl]-4-methyl-3-oxo-9-pentan-2-yl-9-phenyl-2-azaspiro[5.5]undecan-5-yl]pentanenitrile.
| Compound Name | 5-[2-[(4-methoxyphenyl)methyl]-4-methyl-3-oxo-9-pentan-2-yl-9-phenyl-2-azaspiro[5.5]undecan-5-yl]pentanenitrile |
|---|---|
| PubChem CID | 130248136 |
| Molecular Formula | C35H48N2O2 |
| Molecular Weight | 528.78 g/mol |
| Exact Mass | 528.37 |
| IUPAC Name | 5-[2-[(4-methoxyphenyl)methyl]-4-methyl-3-oxo-9-pentan-2-yl-9-phenyl-2-azaspiro[5.5]undecan-5-yl]pentanenitrile |
| SMILES | CCCC(C)C1(c2ccccc2)CCC2(CC1)CN(Cc1ccc(OC)cc1)C(=O)C(C)C2CCCCC#N |
| InChI | InChI=1S/C35H48N2O2/c1-5-12-27(2)35(30-13-8-6-9-14-30)22-20-34(21-23-35)26-37(25-29-16-18-31(39-4)19-17-29)33(38)28(3)32(34)15-10-7-11-24-36/h6,8-9,13-14,16-19,27-28,32H,5,7,10-12,15,20-23,25-26H2,1-4H3 |
| InChIKey | ZVJGTLWCBDWOCM-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.78 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|