C27H37N5O4 — CID 142955776
(6S)-8-benzyl-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;1-(4-methoxyphenyl)-N-methylmethanamine (PubChem CID 142955776) has the molecular formula C27H37N5O4 and a molecular weight of 495.62 g/mol. Its IUPAC name is (6S)-8-benzyl-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;1-(4-methoxyphenyl)-N-methylmethanamine.
| Compound Name | (6S)-8-benzyl-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;1-(4-methoxyphenyl)-N-methylmethanamine |
|---|---|
| PubChem CID | 142955776 |
| Molecular Formula | C27H37N5O4 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.28 |
| IUPAC Name | (6S)-8-benzyl-2-methyl-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;1-(4-methoxyphenyl)-N-methylmethanamine |
| SMILES | CCC[C@H]1C(=O)N(Cc2ccccc2)CC2N1C(=O)CN(C)N2C=O.CNCc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H24N4O3.C9H13NO/c1-3-7-15-18(25)20(10-14-8-5-4-6-9-14)11-16-21(13-23)19(2)12-17(24)22(15)16;1-10-7-8-3-5-9(11-2)6-4-8/h4-6,8-9,13,15-16H,3,7,10-12H2,1-2H3;3-6,10H,7H2,1-2H3/t15-,16?;/m0./s1 |
| InChIKey | DILXBHAYUSJANO-VPVGQWTESA-N |
| XLogP | 2.09 |
| TPSA | 85.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|