C28H40N5O3P — CID 142956319
(6S)-6-benzyl-2-methyl-8-(3-methylbutyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-(4-phosphanylphenyl)methanamine (PubChem CID 142956319) has the molecular formula C28H40N5O3P and a molecular weight of 525.63 g/mol. Its IUPAC name is (6S)-6-benzyl-2-methyl-8-(3-methylbutyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-(4-phosphanylphenyl)methanamine.
| Compound Name | (6S)-6-benzyl-2-methyl-8-(3-methylbutyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-(4-phosphanylphenyl)methanamine |
|---|---|
| PubChem CID | 142956319 |
| Molecular Formula | C28H40N5O3P |
| Molecular Weight | 525.63 g/mol |
| Exact Mass | 525.29 |
| IUPAC Name | (6S)-6-benzyl-2-methyl-8-(3-methylbutyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-(4-phosphanylphenyl)methanamine |
| SMILES | CC(C)CCN1CC2N(C(=O)CN(C)N2C=O)[C@@H](Cc2ccccc2)C1=O.CNCc1ccc(P)cc1 |
| InChI | InChI=1S/C20H28N4O3.C8H12NP/c1-15(2)9-10-22-12-18-23(14-25)21(3)13-19(26)24(18)17(20(22)27)11-16-7-5-4-6-8-16;1-9-6-7-2-4-8(10)5-3-7/h4-8,14-15,17-18H,9-13H2,1-3H3;2-5,9H,6,10H2,1H3/t17-,18?;/m0./s1 |
| InChIKey | TXSFWYJATQRWLA-OQICONIUSA-N |
| XLogP | 1.87 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.63 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|