C19H25FN4O3 — CID 142955984
(6S)-8-[(4-fluorophenyl)methyl]-2-methyl-6-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde (PubChem CID 142955984) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is (6S)-8-[(4-fluorophenyl)methyl]-2-methyl-6-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde.
| Compound Name | (6S)-8-[(4-fluorophenyl)methyl]-2-methyl-6-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde |
|---|---|
| PubChem CID | 142955984 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | (6S)-8-[(4-fluorophenyl)methyl]-2-methyl-6-(2-methylpropyl)-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde |
| SMILES | CC(C)C[C@H]1C(=O)N(Cc2ccc(F)cc2)CC2N1C(=O)CN(C)N2C=O |
| InChI | InChI=1S/C19H25FN4O3/c1-13(2)8-16-19(27)22(9-14-4-6-15(20)7-5-14)10-17-23(12-25)21(3)11-18(26)24(16)17/h4-7,12-13,16-17H,8-11H2,1-3H3/t16-,17?/m0/s1 |
| InChIKey | KUBQYHBNHGBPBC-BHWOMJMDSA-N |
| XLogP | 1.06 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|