C27H36FN5O3 — CID 142955734
1-(4-fluorophenyl)-N-methylmethanamine;(6S)-2-methyl-8-[(4-methylphenyl)methyl]-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde (PubChem CID 142955734) has the molecular formula C27H36FN5O3 and a molecular weight of 497.62 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-methylmethanamine;(6S)-2-methyl-8-[(4-methylphenyl)methyl]-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde.
| Compound Name | 1-(4-fluorophenyl)-N-methylmethanamine;(6S)-2-methyl-8-[(4-methylphenyl)methyl]-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde |
|---|---|
| PubChem CID | 142955734 |
| Molecular Formula | C27H36FN5O3 |
| Molecular Weight | 497.62 g/mol |
| Exact Mass | 497.28 |
| IUPAC Name | 1-(4-fluorophenyl)-N-methylmethanamine;(6S)-2-methyl-8-[(4-methylphenyl)methyl]-4,7-dioxo-6-propyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde |
| SMILES | CCC[C@H]1C(=O)N(Cc2ccc(C)cc2)CC2N1C(=O)CN(C)N2C=O.CNCc1ccc(F)cc1 |
| InChI | InChI=1S/C19H26N4O3.C8H10FN/c1-4-5-16-19(26)21(10-15-8-6-14(2)7-9-15)11-17-22(13-24)20(3)12-18(25)23(16)17;1-10-6-7-2-4-8(9)5-3-7/h6-9,13,16-17H,4-5,10-12H2,1-3H3;2-5,10H,6H2,1H3/t16-,17?;/m0./s1 |
| InChIKey | DWWHIFMAIYUFED-KHTASDDNSA-N |
| XLogP | 2.52 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.62 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|