C29H41N5O3 — CID 143145242
(6S)-8-heptyl-2-methyl-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-phenylmethanamine (PubChem CID 143145242) has the molecular formula C29H41N5O3 and a molecular weight of 507.68 g/mol. Its IUPAC name is (6S)-8-heptyl-2-methyl-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-phenylmethanamine.
| Compound Name | (6S)-8-heptyl-2-methyl-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-phenylmethanamine |
|---|---|
| PubChem CID | 143145242 |
| Molecular Formula | C29H41N5O3 |
| Molecular Weight | 507.68 g/mol |
| Exact Mass | 507.32 |
| IUPAC Name | (6S)-8-heptyl-2-methyl-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde;N-methyl-1-phenylmethanamine |
| SMILES | CCCCCCCN1CC2N(C(=O)CN(C)N2C=O)[C@@H](c2ccccc2)C1=O.CNCc1ccccc1 |
| InChI | InChI=1S/C21H30N4O3.C8H11N/c1-3-4-5-6-10-13-23-14-18-24(16-26)22(2)15-19(27)25(18)20(21(23)28)17-11-8-7-9-12-17;1-9-7-8-5-3-2-4-6-8/h7-9,11-12,16,18,20H,3-6,10,13-15H2,1-2H3;2-6,9H,7H2,1H3/t18?,20-;/m0./s1 |
| InChIKey | LBSQJUGXIOAOEN-PTTASYIOSA-N |
| XLogP | 3.42 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|