C18H21N5O4 — CID 142955651
2-[(6S)-1-formyl-8-(2-methoxyethyl)-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]acetonitrile (PubChem CID 142955651) has the molecular formula C18H21N5O4 and a molecular weight of 371.40 g/mol. Its IUPAC name is 2-[(6S)-1-formyl-8-(2-methoxyethyl)-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]acetonitrile.
| Compound Name | 2-[(6S)-1-formyl-8-(2-methoxyethyl)-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]acetonitrile |
|---|---|
| PubChem CID | 142955651 |
| Molecular Formula | C18H21N5O4 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 2-[(6S)-1-formyl-8-(2-methoxyethyl)-4,7-dioxo-6-phenyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]acetonitrile |
| SMILES | COCCN1CC2N(C(=O)CN(CC#N)N2C=O)[C@@H](c2ccccc2)C1=O |
| InChI | InChI=1S/C18H21N5O4/c1-27-10-9-20-11-15-22(13-24)21(8-7-19)12-16(25)23(15)17(18(20)26)14-5-3-2-4-6-14/h2-6,13,15,17H,8-12H2,1H3/t15?,17-/m0/s1 |
| InChIKey | SKULRWHDKIGANZ-LWKPJOBUSA-N |
| XLogP | -0.42 |
| TPSA | 97.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|