C21H28N6O3 — CID 143144929
(6S)-2-(cyanomethyl)-4,7-dioxo-8-(2-phenylpropyl)-6-propan-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 143144929) has the molecular formula C21H28N6O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is (6S)-2-(cyanomethyl)-4,7-dioxo-8-(2-phenylpropyl)-6-propan-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S)-2-(cyanomethyl)-4,7-dioxo-8-(2-phenylpropyl)-6-propan-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 143144929 |
| Molecular Formula | C21H28N6O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (6S)-2-(cyanomethyl)-4,7-dioxo-8-(2-phenylpropyl)-6-propan-2-yl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CC(CN1CC2N(C(=O)CN(CC#N)N2C(N)=O)[C@@H](C(C)C)C1=O)c1ccccc1 |
| InChI | InChI=1S/C21H28N6O3/c1-14(2)19-20(29)24(11-15(3)16-7-5-4-6-8-16)12-17-26(19)18(28)13-25(10-9-22)27(17)21(23)30/h4-8,14-15,17,19H,10-13H2,1-3H3,(H2,23,30)/t15?,17?,19-/m0/s1 |
| InChIKey | QHWXVYSBFSILIP-KVWWFHCMSA-N |
| XLogP | 0.95 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|