C27H37N5O3 — CID 58887710
(6S,9aS)-N-benzyl-8-(cyclohexylmethyl)-4,7-dioxo-6-propan-2-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58887710) has the molecular formula C27H37N5O3 and a molecular weight of 479.63 g/mol. Its IUPAC name is (6S,9aS)-N-benzyl-8-(cyclohexylmethyl)-4,7-dioxo-6-propan-2-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-N-benzyl-8-(cyclohexylmethyl)-4,7-dioxo-6-propan-2-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58887710 |
| Molecular Formula | C27H37N5O3 |
| Molecular Weight | 479.63 g/mol |
| Exact Mass | 479.29 |
| IUPAC Name | (6S,9aS)-N-benzyl-8-(cyclohexylmethyl)-4,7-dioxo-6-propan-2-yl-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | C#CCN1CC(=O)N2[C@@H](C(C)C)C(=O)N(CC3CCCCC3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C27H37N5O3/c1-4-15-30-19-24(33)31-23(32(30)27(35)28-16-21-11-7-5-8-12-21)18-29(26(34)25(31)20(2)3)17-22-13-9-6-10-14-22/h1,5,7-8,11-12,20,22-23,25H,6,9-10,13-19H2,2-3H3,(H,28,35)/t23-,25-/m0/s1 |
| InChIKey | OUZUFNBZWNHYSR-ZCYQVOJMSA-N |
| XLogP | 2.66 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|