C23H42N6O3 — CID 142956459
(6S)-6-butyl-2-(cyanomethyl)-8-heptyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;propane (PubChem CID 142956459) has the molecular formula C23H42N6O3 and a molecular weight of 450.63 g/mol. Its IUPAC name is (6S)-6-butyl-2-(cyanomethyl)-8-heptyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;propane.
| Compound Name | (6S)-6-butyl-2-(cyanomethyl)-8-heptyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;propane |
|---|---|
| PubChem CID | 142956459 |
| Molecular Formula | C23H42N6O3 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | (6S)-6-butyl-2-(cyanomethyl)-8-heptyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;propane |
| SMILES | CCC.CCCCCCCN1CC2N(C(=O)CN(CC#N)N2C(N)=O)[C@@H](CCCC)C1=O |
| InChI | InChI=1S/C20H34N6O3.C3H8/c1-3-5-7-8-9-12-23-14-17-25(16(19(23)28)10-6-4-2)18(27)15-24(13-11-21)26(17)20(22)29;1-3-2/h16-17H,3-10,12-15H2,1-2H3,(H2,22,29);3H2,1-2H3/t16-,17?;/m0./s1 |
| InChIKey | OUXMWEOGNWZHHQ-KHTASDDNSA-N |
| XLogP | 3.06 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|