C21H32N4O3 — CID 143145096
(9aS)-8-hexyl-6-[(4-hydroxyphenyl)methyl]-1,2-dimethyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione (PubChem CID 143145096) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is (9aS)-8-hexyl-6-[(4-hydroxyphenyl)methyl]-1,2-dimethyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione.
| Compound Name | (9aS)-8-hexyl-6-[(4-hydroxyphenyl)methyl]-1,2-dimethyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
|---|---|
| PubChem CID | 143145096 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | (9aS)-8-hexyl-6-[(4-hydroxyphenyl)methyl]-1,2-dimethyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
| SMILES | CCCCCCN1C[C@H]2N(C(=O)CN(C)N2C)C(Cc2ccc(O)cc2)C1=O |
| InChI | InChI=1S/C21H32N4O3/c1-4-5-6-7-12-24-14-19-23(3)22(2)15-20(27)25(19)18(21(24)28)13-16-8-10-17(26)11-9-16/h8-11,18-19,26H,4-7,12-15H2,1-3H3/t18?,19-/m1/s1 |
| InChIKey | RDWOVORNFQFGHO-MUMRKEEXSA-N |
| XLogP | 1.67 |
| TPSA | 67.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|