C27H32N6O4 — CID 143145425
(6S)-1-acetyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-8-[(1-propylindazol-6-yl)methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione (PubChem CID 143145425) has the molecular formula C27H32N6O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is (6S)-1-acetyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-8-[(1-propylindazol-6-yl)methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione.
| Compound Name | (6S)-1-acetyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-8-[(1-propylindazol-6-yl)methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
|---|---|
| PubChem CID | 143145425 |
| Molecular Formula | C27H32N6O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.25 |
| IUPAC Name | (6S)-1-acetyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-8-[(1-propylindazol-6-yl)methyl]-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-4,7-dione |
| SMILES | CCCn1ncc2ccc(CN3CC4N(C(=O)CN(C)N4C(C)=O)[C@@H](Cc4ccc(O)cc4)C3=O)cc21 |
| InChI | InChI=1S/C27H32N6O4/c1-4-11-31-23-13-20(5-8-21(23)14-28-31)15-30-16-25-32(26(36)17-29(3)33(25)18(2)34)24(27(30)37)12-19-6-9-22(35)10-7-19/h5-10,13-14,24-25,35H,4,11-12,15-17H2,1-3H3/t24-,25?/m0/s1 |
| InChIKey | OYGHJZHYZQJKTN-SKCDSABHSA-N |
| XLogP | 1.97 |
| TPSA | 102.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |