C37H38N8O4 — CID 58887912
(6S,9aS)-8-[[1-[(2-aminophenyl)methyl]indazol-6-yl]methyl]-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide (PubChem CID 58887912) has the molecular formula C37H38N8O4 and a molecular weight of 658.76 g/mol. Its IUPAC name is (6S,9aS)-8-[[1-[(2-aminophenyl)methyl]indazol-6-yl]methyl]-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide.
| Compound Name | (6S,9aS)-8-[[1-[(2-aminophenyl)methyl]indazol-6-yl]methyl]-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
|---|---|
| PubChem CID | 58887912 |
| Molecular Formula | C37H38N8O4 |
| Molecular Weight | 658.76 g/mol |
| Exact Mass | 658.30 |
| IUPAC Name | (6S,9aS)-8-[[1-[(2-aminophenyl)methyl]indazol-6-yl]methyl]-N-benzyl-6-[(4-hydroxyphenyl)methyl]-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide |
| SMILES | CN1CC(=O)N2[C@@H](Cc3ccc(O)cc3)C(=O)N(Cc3ccc4cnn(Cc5ccccc5N)c4c3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C37H38N8O4/c1-41-24-35(47)44-33(17-25-12-15-30(46)16-13-25)36(48)42(23-34(44)45(41)37(49)39-19-26-7-3-2-4-8-26)21-27-11-14-28-20-40-43(32(28)18-27)22-29-9-5-6-10-31(29)38/h2-16,18,20,33-34,46H,17,19,21-24,38H2,1H3,(H,39,49)/t33-,34-/m0/s1 |
| InChIKey | SIOUWVYLBQZMDW-HEVIKAOCSA-N |
| XLogP | 3.55 |
| TPSA | 140.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.76 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|