C25H35N5O3 — CID 143145875
(6S)-6-benzyl-8-(2-methylpropyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;2-methylprop-1-ene (PubChem CID 143145875) has the molecular formula C25H35N5O3 and a molecular weight of 453.59 g/mol. Its IUPAC name is (6S)-6-benzyl-8-(2-methylpropyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;2-methylprop-1-ene.
| Compound Name | (6S)-6-benzyl-8-(2-methylpropyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;2-methylprop-1-ene |
|---|---|
| PubChem CID | 143145875 |
| Molecular Formula | C25H35N5O3 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | (6S)-6-benzyl-8-(2-methylpropyl)-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carboxamide;2-methylprop-1-ene |
| SMILES | C#CCN1CC(=O)N2C(CN(CC(C)C)C(=O)[C@@H]2Cc2ccccc2)N1C(N)=O.C=C(C)C |
| InChI | InChI=1S/C21H27N5O3.C4H8/c1-4-10-24-14-19(27)25-17(11-16-8-6-5-7-9-16)20(28)23(12-15(2)3)13-18(25)26(24)21(22)29;1-4(2)3/h1,5-9,15,17-18H,10-14H2,2-3H3,(H2,22,29);1H2,2-3H3/t17-,18?;/m0./s1 |
| InChIKey | WVJYWOIBTUZLLT-OQICONIUSA-N |
| XLogP | 2.08 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|