C34H47N7O7 — CID 143145748
2-[8-[2-(3,4-dimethoxyphenyl)ethyl]-1-formyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]acetonitrile;N-methyl-1-phenylmethanamine;prop-2-enyl N-propylcarbamate (PubChem CID 143145748) has the molecular formula C34H47N7O7 and a molecular weight of 665.79 g/mol. Its IUPAC name is 2-[8-[2-(3,4-dimethoxyphenyl)ethyl]-1-formyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]acetonitrile;N-methyl-1-phenylmethanamine;prop-2-enyl N-propylcarbamate.
| Compound Name | 2-[8-[2-(3,4-dimethoxyphenyl)ethyl]-1-formyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]acetonitrile;N-methyl-1-phenylmethanamine;prop-2-enyl N-propylcarbamate |
|---|---|
| PubChem CID | 143145748 |
| Molecular Formula | C34H47N7O7 |
| Molecular Weight | 665.79 g/mol |
| Exact Mass | 665.35 |
| IUPAC Name | 2-[8-[2-(3,4-dimethoxyphenyl)ethyl]-1-formyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-2-yl]acetonitrile;N-methyl-1-phenylmethanamine;prop-2-enyl N-propylcarbamate |
| SMILES | C=CCOC(=O)NCCC.CNCc1ccccc1.COc1ccc(CCN2CC3N(CC2=O)C(=O)CN(CC#N)N3C=O)cc1OC |
| InChI | InChI=1S/C19H23N5O5.C8H11N.C7H13NO2/c1-28-15-4-3-14(9-16(15)29-2)5-7-21-10-17-23(12-18(21)26)19(27)11-22(8-6-20)24(17)13-25;1-9-7-8-5-3-2-4-6-8;1-3-5-8-7(9)10-6-4-2/h3-4,9,13,17H,5,7-8,10-12H2,1-2H3;2-6,9H,7H2,1H3;4H,2-3,5-6H2,1H3,(H,8,9) |
| InChIKey | VMSBZDIZALPEJE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 156.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.79 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|