C33H43N7O5 — CID 142955927
prop-2-enyl N-[(4R)-4-[2-(benzylcarbamoyl)-1-(cyanomethyl)-3-[[formyl(2-phenylpropyl)amino]methyl]-5-oxo-1,2,4-triazinan-4-yl]pentyl]carbamate (PubChem CID 142955927) has the molecular formula C33H43N7O5 and a molecular weight of 617.75 g/mol. Its IUPAC name is prop-2-enyl N-[(4R)-4-[2-(benzylcarbamoyl)-1-(cyanomethyl)-3-[[formyl(2-phenylpropyl)amino]methyl]-5-oxo-1,2,4-triazinan-4-yl]pentyl]carbamate.
| Compound Name | prop-2-enyl N-[(4R)-4-[2-(benzylcarbamoyl)-1-(cyanomethyl)-3-[[formyl(2-phenylpropyl)amino]methyl]-5-oxo-1,2,4-triazinan-4-yl]pentyl]carbamate |
|---|---|
| PubChem CID | 142955927 |
| Molecular Formula | C33H43N7O5 |
| Molecular Weight | 617.75 g/mol |
| Exact Mass | 617.33 |
| IUPAC Name | prop-2-enyl N-[(4R)-4-[2-(benzylcarbamoyl)-1-(cyanomethyl)-3-[[formyl(2-phenylpropyl)amino]methyl]-5-oxo-1,2,4-triazinan-4-yl]pentyl]carbamate |
| SMILES | C=CCOC(=O)NCCC[C@@H](C)N1C(=O)CN(CC#N)N(C(=O)NCc2ccccc2)C1CN(C=O)CC(C)c1ccccc1 |
| InChI | InChI=1S/C33H43N7O5/c1-4-20-45-33(44)35-18-11-12-27(3)39-30(23-37(25-41)22-26(2)29-15-9-6-10-16-29)40(38(19-17-34)24-31(39)42)32(43)36-21-28-13-7-5-8-14-28/h4-10,13-16,25-27,30H,1,11-12,18-24H2,2-3H3,(H,35,44)(H,36,43)/t26?,27-,30?/m1/s1 |
| InChIKey | GRFYKMHSAZLOKC-AXOQCKABSA-N |
| XLogP | 3.45 |
| TPSA | 138.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.75 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|