C35H39N5O5 — CID 88584412
3-[(6S,9aS)-1-(benzylcarbamoyl)-8-[(3E,4Z)-3-ethylidene-2-phenylhepta-4,6-dienyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid (PubChem CID 88584412) has the molecular formula C35H39N5O5 and a molecular weight of 609.73 g/mol. Its IUPAC name is 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-[(3E,4Z)-3-ethylidene-2-phenylhepta-4,6-dienyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid.
| Compound Name | 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-[(3E,4Z)-3-ethylidene-2-phenylhepta-4,6-dienyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
|---|---|
| PubChem CID | 88584412 |
| Molecular Formula | C35H39N5O5 |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.30 |
| IUPAC Name | 3-[(6S,9aS)-1-(benzylcarbamoyl)-8-[(3E,4Z)-3-ethylidene-2-phenylhepta-4,6-dienyl]-4,7-dioxo-2-prop-2-ynyl-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazin-6-yl]propanoic acid |
| SMILES | C#CCN1CC(=O)N2[C@@H](CCC(=O)O)C(=O)N(CC(C(/C=C\C=C)=C/C)c3ccccc3)C[C@@H]2N1C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C35H39N5O5/c1-4-7-16-27(6-3)29(28-17-12-9-13-18-28)23-37-24-31-39(30(34(37)44)19-20-33(42)43)32(41)25-38(21-5-2)40(31)35(45)36-22-26-14-10-8-11-15-26/h2,4,6-18,29-31H,1,19-25H2,3H3,(H,36,45)(H,42,43)/b16-7-,27-6+/t29?,30-,31-/m0/s1 |
| InChIKey | IBZQDQSGSKEOEI-KGYYNELRSA-N |
| XLogP | 3.76 |
| TPSA | 113.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|