C19H26N4O4 — CID 143146047
(6S)-6-cyclohepta-2,4,6-trien-1-yl-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde (PubChem CID 143146047) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is (6S)-6-cyclohepta-2,4,6-trien-1-yl-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde.
| Compound Name | (6S)-6-cyclohepta-2,4,6-trien-1-yl-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde |
|---|---|
| PubChem CID | 143146047 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | (6S)-6-cyclohepta-2,4,6-trien-1-yl-8-(3-methoxypropyl)-2-methyl-4,7-dioxo-3,6,9,9a-tetrahydropyrazino[2,1-c][1,2,4]triazine-1-carbaldehyde |
| SMILES | COCCCN1CC2N(C(=O)CN(C)N2C=O)[C@@H](C2C=CC=CC=C2)C1=O |
| InChI | InChI=1S/C19H26N4O4/c1-20-13-17(25)23-16(22(20)14-24)12-21(10-7-11-27-2)19(26)18(23)15-8-5-3-4-6-9-15/h3-6,8-9,14-16,18H,7,10-13H2,1-2H3/t16?,18-/m0/s1 |
| InChIKey | YKCCRIHAFZVMPB-DAFXYXGESA-N |
| XLogP | 0.01 |
| TPSA | 73.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|